C10H13IO3 — CID 118824660
2-ethoxy-3-iodo-1,4-dimethoxybenzene (PubChem CID 118824660) has the molecular formula C10H13IO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-ethoxy-3-iodo-1,4-dimethoxybenzene.
| Compound Name | 2-ethoxy-3-iodo-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 118824660 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-ethoxy-3-iodo-1,4-dimethoxybenzene |
| SMILES | CCOc1c(OC)ccc(OC)c1I |
| InChI | InChI=1S/C10H13IO3/c1-4-14-10-8(13-3)6-5-7(12-2)9(10)11/h5-6H,4H2,1-3H3 |
| InChIKey | QLKZNPAYVGIQHP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|