C10H14INO2 — CID 174519773
3-iodo-2,6-dimethoxy-N,N-dimethylaniline (PubChem CID 174519773) has the molecular formula C10H14INO2 and a molecular weight of 307.13 g/mol. Its IUPAC name is 3-iodo-2,6-dimethoxy-N,N-dimethylaniline.
| Compound Name | 3-iodo-2,6-dimethoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 174519773 |
| Molecular Formula | C10H14INO2 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 3-iodo-2,6-dimethoxy-N,N-dimethylaniline |
| SMILES | COc1ccc(I)c(OC)c1N(C)C |
| InChI | InChI=1S/C10H14INO2/c1-12(2)9-8(13-3)6-5-7(11)10(9)14-4/h5-6H,1-4H3 |
| InChIKey | QBZUVURDNBGCDJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|