About 3-iodo-1,2-dimethoxy-4-methylbenzene
3-iodo-1,2-dimethoxy-4-methylbenzene (PubChem CID 131118438) has the molecular formula C9H11IO2
and a molecular weight of 278.09 g/mol. Its IUPAC name is 3-iodo-1,2-dimethoxy-4-methylbenzene.
Molecular Properties
| Compound Name | 3-iodo-1,2-dimethoxy-4-methylbenzene |
| PubChem CID | 131118438 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 3-iodo-1,2-dimethoxy-4-methylbenzene |
| SMILES | COc1ccc(C)c(I)c1OC |
| InChI | InChI=1S/C9H11IO2/c1-6-4-5-7(11-2)9(12-3)8(6)10/h4-5H,1-3H3 |
| InChIKey | UNQOLYLAZXXFRX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1,2-dimethoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1,2-dimethoxy-4-methylbenzene?
The IUPAC name of 3-iodo-1,2-dimethoxy-4-methylbenzene (CID 131118438) is 3-iodo-1,2-dimethoxy-4-methylbenzene.
What is the SMILES notation for 3-iodo-1,2-dimethoxy-4-methylbenzene?
The canonical SMILES for 3-iodo-1,2-dimethoxy-4-methylbenzene is COc1ccc(C)c(I)c1OC.
What is the InChIKey of 3-iodo-1,2-dimethoxy-4-methylbenzene?
The InChIKey is UNQOLYLAZXXFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IO2/c1-6-4-5-7(11-2)9(12-3)8(6)10/h4-5H,1-3H3.
What are the key properties of 3-iodo-1,2-dimethoxy-4-methylbenzene?
3-iodo-1,2-dimethoxy-4-methylbenzene has a molecular weight of 278.09 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1,2-dimethoxy-4-methylbenzene is sourced from PubChem (CID 131118438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).