C12H20O3 — CID 142152701
ethane;1,2,3-trimethoxy-4-methylbenzene (PubChem CID 142152701) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is ethane;1,2,3-trimethoxy-4-methylbenzene.
| Compound Name | ethane;1,2,3-trimethoxy-4-methylbenzene |
|---|---|
| PubChem CID | 142152701 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethane;1,2,3-trimethoxy-4-methylbenzene |
| SMILES | CC.COc1ccc(C)c(OC)c1OC |
| InChI | InChI=1S/C10H14O3.C2H6/c1-7-5-6-8(11-2)10(13-4)9(7)12-3;1-2/h5-6H,1-4H3;1-2H3 |
| InChIKey | DQIGAHMBKCZRGF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |