methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate

C14H19BrO5 — CID 89424703

IUPACmethyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate
SMILESCOC(=O)C(CCBr)Oc1c(C)ccc(OC)c1OC
InChIInChI=1S/C14H19BrO5/c1-9-5-6-10(17-2)13(18-3)12(9)20-11(7-8-15)14(16)19-4/h5-6,11H,7-8H2,1-4H3
InChIKeyBWWQKKMMYKHLEB-UHFFFAOYSA-N
MW347.21 g/mol
LogP2.72
Rot. Bonds7

About methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate

methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate (PubChem CID 89424703) has the molecular formula C14H19BrO5 and a molecular weight of 347.21 g/mol. Its IUPAC name is methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate.

Molecular Properties

Compound Namemethyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate
PubChem CID89424703
Molecular FormulaC14H19BrO5
Molecular Weight347.21 g/mol
Exact Mass346.04
IUPAC Namemethyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate
SMILESCOC(=O)C(CCBr)Oc1c(C)ccc(OC)c1OC
InChIInChI=1S/C14H19BrO5/c1-9-5-6-10(17-2)13(18-3)12(9)20-11(7-8-15)14(16)19-4/h5-6,11H,7-8H2,1-4H3
InChIKeyBWWQKKMMYKHLEB-UHFFFAOYSA-N
XLogP2.72
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.21
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate?
The IUPAC name of methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate (CID 89424703) is methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate.
What is the SMILES notation for methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate?
The canonical SMILES for methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate is COC(=O)C(CCBr)Oc1c(C)ccc(OC)c1OC.
What is the InChIKey of methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate?
The InChIKey is BWWQKKMMYKHLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrO5/c1-9-5-6-10(17-2)13(18-3)12(9)20-11(7-8-15)14(16)19-4/h5-6,11H,7-8H2,1-4H3.
What are the key properties of methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate?
methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate has a molecular weight of 347.21 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-2-(2,3-dimethoxy-6-methylphenoxy)butanoate is sourced from PubChem (CID 89424703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).