C16H22O3 — CID 143769009
ethane;1,2,6-trimethoxy-7-methylnaphthalene (PubChem CID 143769009) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethane;1,2,6-trimethoxy-7-methylnaphthalene.
| Compound Name | ethane;1,2,6-trimethoxy-7-methylnaphthalene |
|---|---|
| PubChem CID | 143769009 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethane;1,2,6-trimethoxy-7-methylnaphthalene |
| SMILES | CC.COc1cc2ccc(OC)c(OC)c2cc1C |
| InChI | InChI=1S/C14H16O3.C2H6/c1-9-7-11-10(8-13(9)16-3)5-6-12(15-2)14(11)17-4;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | JOZOJVQRPNXFMZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |