C17H17NO3 — CID 70225396
(E)-4-(3,7,8-trimethoxynaphthalen-2-yl)but-3-enenitrile (PubChem CID 70225396) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (E)-4-(3,7,8-trimethoxynaphthalen-2-yl)but-3-enenitrile.
| Compound Name | (E)-4-(3,7,8-trimethoxynaphthalen-2-yl)but-3-enenitrile |
|---|---|
| PubChem CID | 70225396 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (E)-4-(3,7,8-trimethoxynaphthalen-2-yl)but-3-enenitrile |
| SMILES | COc1cc2ccc(OC)c(OC)c2cc1/C=C/CC#N |
| InChI | InChI=1S/C17H17NO3/c1-19-15-8-7-12-11-16(20-2)13(6-4-5-9-18)10-14(12)17(15)21-3/h4,6-8,10-11H,5H2,1-3H3/b6-4+ |
| InChIKey | HDOIMRVIXAZEAO-GQCTYLIASA-N |
| XLogP | 3.79 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |