C14H15BrO3 — CID 15362269
2-bromo-1,5,8-trimethoxy-3-methylnaphthalene (PubChem CID 15362269) has the molecular formula C14H15BrO3 and a molecular weight of 311.18 g/mol. Its IUPAC name is 2-bromo-1,5,8-trimethoxy-3-methylnaphthalene.
| Compound Name | 2-bromo-1,5,8-trimethoxy-3-methylnaphthalene |
|---|---|
| PubChem CID | 15362269 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-bromo-1,5,8-trimethoxy-3-methylnaphthalene |
| SMILES | COc1ccc(OC)c2c(OC)c(Br)c(C)cc12 |
| InChI | InChI=1S/C14H15BrO3/c1-8-7-9-10(16-2)5-6-11(17-3)12(9)14(18-4)13(8)15/h5-7H,1-4H3 |
| InChIKey | KOBSPYIURVJVIJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |