C11H13BrO4 — CID 121224482
methyl 3-bromo-2,6-dimethoxy-4-methylbenzoate (PubChem CID 121224482) has the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. Its IUPAC name is methyl 3-bromo-2,6-dimethoxy-4-methylbenzoate.
| Compound Name | methyl 3-bromo-2,6-dimethoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 121224482 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | methyl 3-bromo-2,6-dimethoxy-4-methylbenzoate |
| SMILES | COC(=O)c1c(OC)cc(C)c(Br)c1OC |
| InChI | InChI=1S/C11H13BrO4/c1-6-5-7(14-2)8(11(13)16-4)10(15-3)9(6)12/h5H,1-4H3 |
| InChIKey | XBZXKCSUUNLUOW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |