C10H12BrNO2 — CID 102741946
methyl 2-amino-6-bromo-3,5-dimethylbenzoate (PubChem CID 102741946) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is methyl 2-amino-6-bromo-3,5-dimethylbenzoate.
| Compound Name | methyl 2-amino-6-bromo-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 102741946 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | methyl 2-amino-6-bromo-3,5-dimethylbenzoate |
| SMILES | COC(=O)c1c(N)c(C)cc(C)c1Br |
| InChI | InChI=1S/C10H12BrNO2/c1-5-4-6(2)9(12)7(8(5)11)10(13)14-3/h4H,12H2,1-3H3 |
| InChIKey | CSWAAPYRGBPCDV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|