About 2-amino-3-bromo-4,6-dimethylbenzoic acid
2-amino-3-bromo-4,6-dimethylbenzoic acid (PubChem CID 139311002) has the molecular formula C9H10BrNO2
and a molecular weight of 244.09 g/mol. Its IUPAC name is 2-amino-3-bromo-4,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 2-amino-3-bromo-4,6-dimethylbenzoic acid |
| PubChem CID | 139311002 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-amino-3-bromo-4,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(N)c1Br |
| InChI | InChI=1S/C9H10BrNO2/c1-4-3-5(2)7(10)8(11)6(4)9(12)13/h3H,11H2,1-2H3,(H,12,13) |
| InChIKey | BYBJHACOXPSAHS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-bromo-4,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-bromo-4,6-dimethylbenzoic acid?
The IUPAC name of 2-amino-3-bromo-4,6-dimethylbenzoic acid (CID 139311002) is 2-amino-3-bromo-4,6-dimethylbenzoic acid.
What is the SMILES notation for 2-amino-3-bromo-4,6-dimethylbenzoic acid?
The canonical SMILES for 2-amino-3-bromo-4,6-dimethylbenzoic acid is Cc1cc(C)c(C(=O)O)c(N)c1Br.
What is the InChIKey of 2-amino-3-bromo-4,6-dimethylbenzoic acid?
The InChIKey is BYBJHACOXPSAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2/c1-4-3-5(2)7(10)8(11)6(4)9(12)13/h3H,11H2,1-2H3,(H,12,13).
What are the key properties of 2-amino-3-bromo-4,6-dimethylbenzoic acid?
2-amino-3-bromo-4,6-dimethylbenzoic acid has a molecular weight of 244.09 g/mol, XLogP of 2.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-bromo-4,6-dimethylbenzoic acid is sourced from PubChem (CID 139311002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).