C8H9BrN2O2 — CID 150589706
2,6-diamino-4-bromo-3-methylbenzoic acid (PubChem CID 150589706) has the molecular formula C8H9BrN2O2 and a molecular weight of 245.08 g/mol. Its IUPAC name is 2,6-diamino-4-bromo-3-methylbenzoic acid.
| Compound Name | 2,6-diamino-4-bromo-3-methylbenzoic acid |
|---|---|
| PubChem CID | 150589706 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 2,6-diamino-4-bromo-3-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(N)c(C(=O)O)c1N |
| InChI | InChI=1S/C8H9BrN2O2/c1-3-4(9)2-5(10)6(7(3)11)8(12)13/h2H,10-11H2,1H3,(H,12,13) |
| InChIKey | IPPKPJKOLDCSTJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|