2-amino-6-bromo-4-fluorobenzoic acid

C7H5BrFNO2 — CID 122237255

IUPAC2-amino-6-bromo-4-fluorobenzoic acid
SMILESNc1cc(F)cc(Br)c1C(=O)O
InChIInChI=1S/C7H5BrFNO2/c8-4-1-3(9)2-5(10)6(4)7(11)12/h1-2H,10H2,(H,11,12)
InChIKeySMRSKCPCQDQOAS-UHFFFAOYSA-N
MW234.02 g/mol
LogP1.87
Rot. Bonds1

About 2-amino-6-bromo-4-fluorobenzoic acid

2-amino-6-bromo-4-fluorobenzoic acid (PubChem CID 122237255) has the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. Its IUPAC name is 2-amino-6-bromo-4-fluorobenzoic acid.

Molecular Properties

Compound Name2-amino-6-bromo-4-fluorobenzoic acid
PubChem CID122237255
Molecular FormulaC7H5BrFNO2
Molecular Weight234.02 g/mol
Exact Mass232.95
IUPAC Name2-amino-6-bromo-4-fluorobenzoic acid
SMILESNc1cc(F)cc(Br)c1C(=O)O
InChIInChI=1S/C7H5BrFNO2/c8-4-1-3(9)2-5(10)6(4)7(11)12/h1-2H,10H2,(H,11,12)
InChIKeySMRSKCPCQDQOAS-UHFFFAOYSA-N
XLogP1.87
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.02
LogP ≤ 51.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-6-bromo-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-4,6-dibromobenzoic acid
CID 12868557
(2S)-2-amino-4-(2-amino-6-bromo-4-fluorophenyl)-4-oxobutanoic acid
CID 18656063
2-amino-4,6-dibromo-3-fluorobenzoic acid
CID 169315421
2-amino-4-bromo-6-fluorobenzoic acid
CID 67257607
2-bromo-6-cyano-4-fluorobenzoic acid
CID 119007082
2-amino-6-bromobenzoic acid
CID 10560649
2,6-diamino-4-bromo-3-methylbenzoic acid
CID 150589706
2-amino-4-bromo-6-fluoro-3-hydroxybenzoic acid
CID 54312938
4-amino-2-bromo-6-iodobenzoic acid
CID 166642106
4-bromo-6-fluoro-1H-indole-2-carboxylic acid
CID 83901550
2-bromo-6-fluoro-4-iodobenzoic acid
CID 74892438
1-(2-bromo-4-fluoro-6-methylphenyl)ethanone
CID 53402494

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-bromo-4-fluorobenzoic acid?
The IUPAC name of 2-amino-6-bromo-4-fluorobenzoic acid (CID 122237255) is 2-amino-6-bromo-4-fluorobenzoic acid.
What is the SMILES notation for 2-amino-6-bromo-4-fluorobenzoic acid?
The canonical SMILES for 2-amino-6-bromo-4-fluorobenzoic acid is Nc1cc(F)cc(Br)c1C(=O)O.
What is the InChIKey of 2-amino-6-bromo-4-fluorobenzoic acid?
The InChIKey is SMRSKCPCQDQOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrFNO2/c8-4-1-3(9)2-5(10)6(4)7(11)12/h1-2H,10H2,(H,11,12).
What are the key properties of 2-amino-6-bromo-4-fluorobenzoic acid?
2-amino-6-bromo-4-fluorobenzoic acid has a molecular weight of 234.02 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-bromo-4-fluorobenzoic acid is sourced from PubChem (CID 122237255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).