C24H30O4 — CID 101483124
3-[4-(3-carboxy-2,4,6-trimethylphenyl)butyl]-2,4,6-trimethylbenzoic acid (PubChem CID 101483124) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-[4-(3-carboxy-2,4,6-trimethylphenyl)butyl]-2,4,6-trimethylbenzoic acid.
| Compound Name | 3-[4-(3-carboxy-2,4,6-trimethylphenyl)butyl]-2,4,6-trimethylbenzoic acid |
|---|---|
| PubChem CID | 101483124 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-[4-(3-carboxy-2,4,6-trimethylphenyl)butyl]-2,4,6-trimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(C)c1CCCCc1c(C)cc(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C24H30O4/c1-13-11-15(3)21(23(25)26)17(5)19(13)9-7-8-10-20-14(2)12-16(4)22(18(20)6)24(27)28/h11-12H,7-10H2,1-6H3,(H,25,26)(H,27,28) |
| InChIKey | ATSCZVBHFCCRLK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|