About anthracene-9-carboxylic acid
anthracene-9-carboxylic acid (PubChem CID 2201) has the molecular formula C15H10O2
and a molecular weight of 222.24 g/mol. Its IUPAC name is anthracene-9-carboxylic acid.
Molecular Properties
| Compound Name | anthracene-9-carboxylic acid |
| PubChem CID | 2201 |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | anthracene-9-carboxylic acid |
| SMILES | O=C(O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17) |
| InChIKey | XGWFJBFNAQHLEF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9-carboxylic acid?
The IUPAC name of anthracene-9-carboxylic acid (CID 2201) is anthracene-9-carboxylic acid.
What is the SMILES notation for anthracene-9-carboxylic acid?
The canonical SMILES for anthracene-9-carboxylic acid is O=C(O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracene-9-carboxylic acid?
The InChIKey is XGWFJBFNAQHLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17).
What are the key properties of anthracene-9-carboxylic acid?
anthracene-9-carboxylic acid has a molecular weight of 222.24 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9-carboxylic acid is sourced from PubChem (CID 2201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).