anthracene-9-carboxylic acid

C15H10O2 — CID 2201

IUPACanthracene-9-carboxylic acid
SMILESO=C(O)c1c2ccccc2cc2ccccc12
InChIInChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17)
InChIKeyXGWFJBFNAQHLEF-UHFFFAOYSA-N
MW222.24 g/mol
LogP3.69
Rot. Bonds1

About anthracene-9-carboxylic acid

anthracene-9-carboxylic acid (PubChem CID 2201) has the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. Its IUPAC name is anthracene-9-carboxylic acid.

Molecular Properties

Compound Nameanthracene-9-carboxylic acid
PubChem CID2201
Molecular FormulaC15H10O2
Molecular Weight222.24 g/mol
Exact Mass222.07
IUPAC Nameanthracene-9-carboxylic acid
SMILESO=C(O)c1c2ccccc2cc2ccccc12
InChIInChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17)
InChIKeyXGWFJBFNAQHLEF-UHFFFAOYSA-N
XLogP3.69
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.24
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze anthracene-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of anthracene-9-carboxylic acid?
The IUPAC name of anthracene-9-carboxylic acid (CID 2201) is anthracene-9-carboxylic acid.
What is the SMILES notation for anthracene-9-carboxylic acid?
The canonical SMILES for anthracene-9-carboxylic acid is O=C(O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracene-9-carboxylic acid?
The InChIKey is XGWFJBFNAQHLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17).
What are the key properties of anthracene-9-carboxylic acid?
anthracene-9-carboxylic acid has a molecular weight of 222.24 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9-carboxylic acid is sourced from PubChem (CID 2201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).