C16H16BrNO3 — CID 107722649
2-amino-5-(4-bromo-3,5-dimethylphenoxy)-3-methylbenzoic acid (PubChem CID 107722649) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-amino-5-(4-bromo-3,5-dimethylphenoxy)-3-methylbenzoic acid.
| Compound Name | 2-amino-5-(4-bromo-3,5-dimethylphenoxy)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107722649 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-amino-5-(4-bromo-3,5-dimethylphenoxy)-3-methylbenzoic acid |
| SMILES | Cc1cc(Oc2cc(C)c(Br)c(C)c2)cc(C(=O)O)c1N |
| InChI | InChI=1S/C16H16BrNO3/c1-8-4-11(5-9(2)14(8)17)21-12-6-10(3)15(18)13(7-12)16(19)20/h4-7H,18H2,1-3H3,(H,19,20) |
| InChIKey | ZKDZDLQBNUXBOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|