C13H11BrO3S — CID 107724907
4-(4-bromo-3,5-dimethylphenoxy)thiophene-2-carboxylic acid (PubChem CID 107724907) has the molecular formula C13H11BrO3S and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylphenoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-(4-bromo-3,5-dimethylphenoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107724907 |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylphenoxy)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(Oc2csc(C(=O)O)c2)cc(C)c1Br |
| InChI | InChI=1S/C13H11BrO3S/c1-7-3-9(4-8(2)12(7)14)17-10-5-11(13(15)16)18-6-10/h3-6H,1-2H3,(H,15,16) |
| InChIKey | MURHJBOWFNBKBR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |