C13H12O5S — CID 113404010
4-(2,6-dimethoxyphenoxy)thiophene-2-carboxylic acid (PubChem CID 113404010) has the molecular formula C13H12O5S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-(2,6-dimethoxyphenoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 113404010 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)thiophene-2-carboxylic acid |
| SMILES | COc1cccc(OC)c1Oc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C13H12O5S/c1-16-9-4-3-5-10(17-2)12(9)18-8-6-11(13(14)15)19-7-8/h3-7H,1-2H3,(H,14,15) |
| InChIKey | PRECKEQFTMZWNX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |