C16H16O5 — CID 62136478
4-(2,6-dimethoxyphenoxy)-2-methylbenzoic acid (PubChem CID 62136478) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenoxy)-2-methylbenzoic acid.
| Compound Name | 4-(2,6-dimethoxyphenoxy)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 62136478 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-(2,6-dimethoxyphenoxy)-2-methylbenzoic acid |
| SMILES | COc1cccc(OC)c1Oc1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C16H16O5/c1-10-9-11(7-8-12(10)16(17)18)21-15-13(19-2)5-4-6-14(15)20-3/h4-9H,1-3H3,(H,17,18) |
| InChIKey | AVLJPKGNPQQCOU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |