C20H24O6 — CID 70358573
2-methyl-4-[1-(3,4,5-trimethoxyphenyl)propoxy]benzoic acid (PubChem CID 70358573) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-methyl-4-[1-(3,4,5-trimethoxyphenyl)propoxy]benzoic acid.
| Compound Name | 2-methyl-4-[1-(3,4,5-trimethoxyphenyl)propoxy]benzoic acid |
|---|---|
| PubChem CID | 70358573 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-methyl-4-[1-(3,4,5-trimethoxyphenyl)propoxy]benzoic acid |
| SMILES | CCC(Oc1ccc(C(=O)O)c(C)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24O6/c1-6-16(26-14-7-8-15(20(21)22)12(2)9-14)13-10-17(23-3)19(25-5)18(11-13)24-4/h7-11,16H,6H2,1-5H3,(H,21,22) |
| InChIKey | OCUDFSIGABRASD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |