2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid

C19H22O5 — CID 70358731

IUPAC2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid
SMILESCOc1cc(C(C)c2cccc(C(=O)O)c2C)cc(OC)c1OC
InChIInChI=1S/C19H22O5/c1-11(14-7-6-8-15(12(14)2)19(20)21)13-9-16(22-3)18(24-5)17(10-13)23-4/h6-11H,1-5H3,(H,20,21)
InChIKeyAUEQDTPFAUBJDK-UHFFFAOYSA-N
MW330.38 g/mol
LogP3.87
Rot. Bonds6

About 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid

2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid (PubChem CID 70358731) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid.

Molecular Properties

Compound Name2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid
PubChem CID70358731
Molecular FormulaC19H22O5
Molecular Weight330.38 g/mol
Exact Mass330.15
IUPAC Name2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid
SMILESCOc1cc(C(C)c2cccc(C(=O)O)c2C)cc(OC)c1OC
InChIInChI=1S/C19H22O5/c1-11(14-7-6-8-15(12(14)2)19(20)21)13-9-16(22-3)18(24-5)17(10-13)23-4/h6-11H,1-5H3,(H,20,21)
InChIKeyAUEQDTPFAUBJDK-UHFFFAOYSA-N
XLogP3.87
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.38
LogP ≤ 53.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid?
The IUPAC name of 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid (CID 70358731) is 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid.
What is the SMILES notation for 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid?
The canonical SMILES for 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid is COc1cc(C(C)c2cccc(C(=O)O)c2C)cc(OC)c1OC.
What is the InChIKey of 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid?
The InChIKey is AUEQDTPFAUBJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O5/c1-11(14-7-6-8-15(12(14)2)19(20)21)13-9-16(22-3)18(24-5)17(10-13)23-4/h6-11H,1-5H3,(H,20,21).
What are the key properties of 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid?
2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid has a molecular weight of 330.38 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethyl]benzoic acid is sourced from PubChem (CID 70358731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).