C12H16O5 — CID 175270418
2-methylbenzene-1,3-dicarboxylic acid;propan-2-ol (PubChem CID 175270418) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;propan-2-ol.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;propan-2-ol |
|---|---|
| PubChem CID | 175270418 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;propan-2-ol |
| SMILES | CC(C)O.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C3H8O/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-3(2)4/h2-4H,1H3,(H,10,11)(H,12,13);3-4H,1-2H3 |
| InChIKey | FPXCCQGBCKGPRV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |