C12H16O4S — CID 161282973
2-methylbenzene-1,3-dicarboxylic acid;propane-1-thiol (PubChem CID 161282973) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;propane-1-thiol.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;propane-1-thiol |
|---|---|
| PubChem CID | 161282973 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;propane-1-thiol |
| SMILES | CCCS.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C3H8S/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-2-3-4/h2-4H,1H3,(H,10,11)(H,12,13);4H,2-3H2,1H3 |
| InChIKey | VFIJIZLNRLYZNZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|