2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid

C19H22O6 — CID 70358433

IUPAC2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid
SMILESCOc1cc(COCc2ccc(C(=O)O)c(C)c2)cc(OC)c1OC
InChIInChI=1S/C19H22O6/c1-12-7-13(5-6-15(12)19(20)21)10-25-11-14-8-16(22-2)18(24-4)17(9-14)23-3/h5-9H,10-11H2,1-4H3,(H,20,21)
InChIKeyPHGNJOZXJSQHAO-UHFFFAOYSA-N
MW346.38 g/mol
LogP3.44
Rot. Bonds8

About 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid

2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid (PubChem CID 70358433) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid.

Molecular Properties

Compound Name2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid
PubChem CID70358433
Molecular FormulaC19H22O6
Molecular Weight346.38 g/mol
Exact Mass346.14
IUPAC Name2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid
SMILESCOc1cc(COCc2ccc(C(=O)O)c(C)c2)cc(OC)c1OC
InChIInChI=1S/C19H22O6/c1-12-7-13(5-6-15(12)19(20)21)10-25-11-14-8-16(22-2)18(24-4)17(9-14)23-3/h5-9H,10-11H2,1-4H3,(H,20,21)
InChIKeyPHGNJOZXJSQHAO-UHFFFAOYSA-N
XLogP3.44
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.38
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid?
The IUPAC name of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid (CID 70358433) is 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid.
What is the SMILES notation for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid?
The canonical SMILES for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid is COc1cc(COCc2ccc(C(=O)O)c(C)c2)cc(OC)c1OC.
What is the InChIKey of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid?
The InChIKey is PHGNJOZXJSQHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O6/c1-12-7-13(5-6-15(12)19(20)21)10-25-11-14-8-16(22-2)18(24-4)17(9-14)23-3/h5-9H,10-11H2,1-4H3,(H,20,21).
What are the key properties of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid?
2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid has a molecular weight of 346.38 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methoxymethyl]benzoic acid is sourced from PubChem (CID 70358433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).