About 4-ethyl-2-methoxybenzoic acid
4-ethyl-2-methoxybenzoic acid (PubChem CID 18687349) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-ethyl-2-methoxybenzoic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-methoxybenzoic acid |
| PubChem CID | 18687349 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-ethyl-2-methoxybenzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C10H12O3/c1-3-7-4-5-8(10(11)12)9(6-7)13-2/h4-6H,3H2,1-2H3,(H,11,12) |
| InChIKey | YFSSJMUFERUXAC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methoxybenzoic acid?
The IUPAC name of 4-ethyl-2-methoxybenzoic acid (CID 18687349) is 4-ethyl-2-methoxybenzoic acid.
What is the SMILES notation for 4-ethyl-2-methoxybenzoic acid?
The canonical SMILES for 4-ethyl-2-methoxybenzoic acid is CCc1ccc(C(=O)O)c(OC)c1.
What is the InChIKey of 4-ethyl-2-methoxybenzoic acid?
The InChIKey is YFSSJMUFERUXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-3-7-4-5-8(10(11)12)9(6-7)13-2/h4-6H,3H2,1-2H3,(H,11,12).
What are the key properties of 4-ethyl-2-methoxybenzoic acid?
4-ethyl-2-methoxybenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methoxybenzoic acid is sourced from PubChem (CID 18687349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).