C15H18O2S — CID 15365946
5,8-dimethoxy-2,3-dimethyl-1-methylsulfanylnaphthalene (PubChem CID 15365946) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 5,8-dimethoxy-2,3-dimethyl-1-methylsulfanylnaphthalene.
| Compound Name | 5,8-dimethoxy-2,3-dimethyl-1-methylsulfanylnaphthalene |
|---|---|
| PubChem CID | 15365946 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5,8-dimethoxy-2,3-dimethyl-1-methylsulfanylnaphthalene |
| SMILES | COc1ccc(OC)c2c(SC)c(C)c(C)cc12 |
| InChI | InChI=1S/C15H18O2S/c1-9-8-11-12(16-3)6-7-13(17-4)14(11)15(18-5)10(9)2/h6-8H,1-5H3 |
| InChIKey | ZCNIOESSCRMEEM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |