C9H11BrO2S — CID 15692127
1-bromo-3,4-dimethoxy-2-methylsulfanylbenzene (PubChem CID 15692127) has the molecular formula C9H11BrO2S and a molecular weight of 263.16 g/mol. Its IUPAC name is 1-bromo-3,4-dimethoxy-2-methylsulfanylbenzene.
| Compound Name | 1-bromo-3,4-dimethoxy-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 15692127 |
| Molecular Formula | C9H11BrO2S |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1-bromo-3,4-dimethoxy-2-methylsulfanylbenzene |
| SMILES | COc1ccc(Br)c(SC)c1OC |
| InChI | InChI=1S/C9H11BrO2S/c1-11-7-5-4-6(10)9(13-3)8(7)12-2/h4-5H,1-3H3 |
| InChIKey | HHXGBCTYZFVAEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |