C8H7BrF2OS — CID 163198255
1-bromo-2,3-difluoro-5-methoxy-4-methylsulfanylbenzene (PubChem CID 163198255) has the molecular formula C8H7BrF2OS and a molecular weight of 269.11 g/mol. Its IUPAC name is 1-bromo-2,3-difluoro-5-methoxy-4-methylsulfanylbenzene.
| Compound Name | 1-bromo-2,3-difluoro-5-methoxy-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 163198255 |
| Molecular Formula | C8H7BrF2OS |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 1-bromo-2,3-difluoro-5-methoxy-4-methylsulfanylbenzene |
| SMILES | COc1cc(Br)c(F)c(F)c1SC |
| InChI | InChI=1S/C8H7BrF2OS/c1-12-5-3-4(9)6(10)7(11)8(5)13-2/h3H,1-2H3 |
| InChIKey | QAFCVPYSPIJOOG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|