C8H9BF2O3S — CID 164890866
(2,3-difluoro-5-methoxy-4-methylsulfanylphenyl)boronic acid (PubChem CID 164890866) has the molecular formula C8H9BF2O3S and a molecular weight of 234.03 g/mol. Its IUPAC name is (2,3-difluoro-5-methoxy-4-methylsulfanylphenyl)boronic acid.
| Compound Name | (2,3-difluoro-5-methoxy-4-methylsulfanylphenyl)boronic acid |
|---|---|
| PubChem CID | 164890866 |
| Molecular Formula | C8H9BF2O3S |
| Molecular Weight | 234.03 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (2,3-difluoro-5-methoxy-4-methylsulfanylphenyl)boronic acid |
| SMILES | COc1cc(B(O)O)c(F)c(F)c1SC |
| InChI | InChI=1S/C8H9BF2O3S/c1-14-5-3-4(9(12)13)6(10)7(11)8(5)15-2/h3,12-13H,1-2H3 |
| InChIKey | CBWNBPIEGQSRLB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.03 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|