C9H11FO2S — CID 130925961
2-fluoro-1,3-dimethoxy-5-methylsulfanylbenzene (PubChem CID 130925961) has the molecular formula C9H11FO2S and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethoxy-5-methylsulfanylbenzene.
| Compound Name | 2-fluoro-1,3-dimethoxy-5-methylsulfanylbenzene |
|---|---|
| PubChem CID | 130925961 |
| Molecular Formula | C9H11FO2S |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-fluoro-1,3-dimethoxy-5-methylsulfanylbenzene |
| SMILES | COc1cc(SC)cc(OC)c1F |
| InChI | InChI=1S/C9H11FO2S/c1-11-7-4-6(13-3)5-8(12-2)9(7)10/h4-5H,1-3H3 |
| InChIKey | WZYIVDBBAQQWSP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |