C7H7BF2O4 — CID 142794530
(3,4-difluoro-5-methoxyphenoxy)boronic acid (PubChem CID 142794530) has the molecular formula C7H7BF2O4 and a molecular weight of 203.94 g/mol. Its IUPAC name is (3,4-difluoro-5-methoxyphenoxy)boronic acid.
| Compound Name | (3,4-difluoro-5-methoxyphenoxy)boronic acid |
|---|---|
| PubChem CID | 142794530 |
| Molecular Formula | C7H7BF2O4 |
| Molecular Weight | 203.94 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (3,4-difluoro-5-methoxyphenoxy)boronic acid |
| SMILES | COc1cc(OB(O)O)cc(F)c1F |
| InChI | InChI=1S/C7H7BF2O4/c1-13-6-3-4(14-8(11)12)2-5(9)7(6)10/h2-3,11-12H,1H3 |
| InChIKey | TXJYLPAPQALPEP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.94 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|