C8H7F3O2 — CID 10535733
1,2,4-trifluoro-3,5-dimethoxybenzene (PubChem CID 10535733) has the molecular formula C8H7F3O2 and a molecular weight of 192.14 g/mol. Its IUPAC name is 1,2,4-trifluoro-3,5-dimethoxybenzene.
| Compound Name | 1,2,4-trifluoro-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 10535733 |
| Molecular Formula | C8H7F3O2 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 1,2,4-trifluoro-3,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(F)c(OC)c1F |
| InChI | InChI=1S/C8H7F3O2/c1-12-5-3-4(9)6(10)8(13-2)7(5)11/h3H,1-2H3 |
| InChIKey | AXSBVNAPIRNPHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|