C21H13AlF8O3 — CID 177045728
(2,6-difluoro-3-methoxyphenyl)-bis(2,3,5-trifluoro-6-methoxyphenyl)alumane (PubChem CID 177045728) has the molecular formula C21H13AlF8O3 and a molecular weight of 492.30 g/mol. Its IUPAC name is (2,6-difluoro-3-methoxyphenyl)-bis(2,3,5-trifluoro-6-methoxyphenyl)alumane.
| Compound Name | (2,6-difluoro-3-methoxyphenyl)-bis(2,3,5-trifluoro-6-methoxyphenyl)alumane |
|---|---|
| PubChem CID | 177045728 |
| Molecular Formula | C21H13AlF8O3 |
| Molecular Weight | 492.30 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | (2,6-difluoro-3-methoxyphenyl)-bis(2,3,5-trifluoro-6-methoxyphenyl)alumane |
| SMILES | COc1ccc(F)c([Al](c2c(F)c(F)cc(F)c2OC)c2c(F)c(F)cc(F)c2OC)c1F |
| InChI | InChI=1S/2C7H4F3O.C7H5F2O.Al/c2*1-11-7-3-5(9)4(8)2-6(7)10;1-10-7-3-2-5(8)4-6(7)9;/h2*2H,1H3;2-3H,1H3; |
| InChIKey | BCGVQXAJMWATFZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|