C7H5ClF2O — CID 121229982
2-chloro-1,3-difluoro-4-methoxybenzene (PubChem CID 121229982) has the molecular formula C7H5ClF2O and a molecular weight of 178.56 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-4-methoxybenzene.
| Compound Name | 2-chloro-1,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 121229982 |
| Molecular Formula | C7H5ClF2O |
| Molecular Weight | 178.56 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 2-chloro-1,3-difluoro-4-methoxybenzene |
| SMILES | COc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H5ClF2O/c1-11-5-3-2-4(9)6(8)7(5)10/h2-3H,1H3 |
| InChIKey | SNCPDLGXNVBGMB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|