C13H9ClF2O — CID 174993778
3-(2-chlorophenyl)-1,2-difluoro-4-methoxybenzene (PubChem CID 174993778) has the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,2-difluoro-4-methoxybenzene.
| Compound Name | 3-(2-chlorophenyl)-1,2-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 174993778 |
| Molecular Formula | C13H9ClF2O |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3-(2-chlorophenyl)-1,2-difluoro-4-methoxybenzene |
| SMILES | COc1ccc(F)c(F)c1-c1ccccc1Cl |
| InChI | InChI=1S/C13H9ClF2O/c1-17-11-7-6-10(15)13(16)12(11)8-4-2-3-5-9(8)14/h2-7H,1H3 |
| InChIKey | CBAZUOXARXFQEF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |