C13H6ClF5O — CID 134629660
1-(5-chloro-2-methoxyphenyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 134629660) has the molecular formula C13H6ClF5O and a molecular weight of 308.63 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 134629660 |
| Molecular Formula | C13H6ClF5O |
| Molecular Weight | 308.63 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | COc1ccc(Cl)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6ClF5O/c1-20-7-3-2-5(14)4-6(7)8-9(15)11(17)13(19)12(18)10(8)16/h2-4H,1H3 |
| InChIKey | MBSAMPVILYIRMJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|