C16H15F5O — CID 144565369
ethane;1,2,3,4,5-pentafluoro-6-(2-methoxy-5-methylphenyl)benzene (PubChem CID 144565369) has the molecular formula C16H15F5O and a molecular weight of 318.29 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentafluoro-6-(2-methoxy-5-methylphenyl)benzene.
| Compound Name | ethane;1,2,3,4,5-pentafluoro-6-(2-methoxy-5-methylphenyl)benzene |
|---|---|
| PubChem CID | 144565369 |
| Molecular Formula | C16H15F5O |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | ethane;1,2,3,4,5-pentafluoro-6-(2-methoxy-5-methylphenyl)benzene |
| SMILES | CC.COc1ccc(C)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H9F5O.C2H6/c1-6-3-4-8(20-2)7(5-6)9-10(15)12(17)14(19)13(18)11(9)16;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | ITFMZWNIYFDCET-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|