C7H6ClF2NO — CID 106701641
2-chloro-3,6-difluoro-4-methoxyaniline (PubChem CID 106701641) has the molecular formula C7H6ClF2NO and a molecular weight of 193.58 g/mol. Its IUPAC name is 2-chloro-3,6-difluoro-4-methoxyaniline.
| Compound Name | 2-chloro-3,6-difluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 106701641 |
| Molecular Formula | C7H6ClF2NO |
| Molecular Weight | 193.58 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 2-chloro-3,6-difluoro-4-methoxyaniline |
| SMILES | COc1cc(F)c(N)c(Cl)c1F |
| InChI | InChI=1S/C7H6ClF2NO/c1-12-4-2-3(9)7(11)5(8)6(4)10/h2H,11H2,1H3 |
| InChIKey | WLODRHQWKSLHMO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|