C6H3ClF3N — CID 71758632
3-chloro-2,4,6-trifluoroaniline (PubChem CID 71758632) has the molecular formula C6H3ClF3N and a molecular weight of 181.54 g/mol. Its IUPAC name is 3-chloro-2,4,6-trifluoroaniline.
| Compound Name | 3-chloro-2,4,6-trifluoroaniline |
|---|---|
| PubChem CID | 71758632 |
| Molecular Formula | C6H3ClF3N |
| Molecular Weight | 181.54 g/mol |
| Exact Mass | 180.99 |
| IUPAC Name | 3-chloro-2,4,6-trifluoroaniline |
| SMILES | Nc1c(F)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C6H3ClF3N/c7-4-2(8)1-3(9)6(11)5(4)10/h1H,11H2 |
| InChIKey | IZVNZHYBSJJGAI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|