C7H5ClF3N — CID 117110798
(4-chloro-2,3,5-trifluorophenyl)methanamine (PubChem CID 117110798) has the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. Its IUPAC name is (4-chloro-2,3,5-trifluorophenyl)methanamine.
| Compound Name | (4-chloro-2,3,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 117110798 |
| Molecular Formula | C7H5ClF3N |
| Molecular Weight | 195.57 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | (4-chloro-2,3,5-trifluorophenyl)methanamine |
| SMILES | NCc1cc(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C7H5ClF3N/c8-5-4(9)1-3(2-12)6(10)7(5)11/h1H,2,12H2 |
| InChIKey | FCDUCVJMVJUOPC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|