C9H11ClFN — CID 84770610
(5-chloro-3-fluoro-2,4-dimethylphenyl)methanamine (PubChem CID 84770610) has the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. Its IUPAC name is (5-chloro-3-fluoro-2,4-dimethylphenyl)methanamine.
| Compound Name | (5-chloro-3-fluoro-2,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 84770610 |
| Molecular Formula | C9H11ClFN |
| Molecular Weight | 187.64 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (5-chloro-3-fluoro-2,4-dimethylphenyl)methanamine |
| SMILES | Cc1c(Cl)cc(CN)c(C)c1F |
| InChI | InChI=1S/C9H11ClFN/c1-5-7(4-12)3-8(10)6(2)9(5)11/h3H,4,12H2,1-2H3 |
| InChIKey | GAZMBQKFVFUXRR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |