C9H8Cl2F2 — CID 155380165
2,4-dichloro-1,5-difluoro-3-propan-2-ylbenzene (PubChem CID 155380165) has the molecular formula C9H8Cl2F2 and a molecular weight of 225.06 g/mol. Its IUPAC name is 2,4-dichloro-1,5-difluoro-3-propan-2-ylbenzene.
| Compound Name | 2,4-dichloro-1,5-difluoro-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 155380165 |
| Molecular Formula | C9H8Cl2F2 |
| Molecular Weight | 225.06 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2,4-dichloro-1,5-difluoro-3-propan-2-ylbenzene |
| SMILES | CC(C)c1c(Cl)c(F)cc(F)c1Cl |
| InChI | InChI=1S/C9H8Cl2F2/c1-4(2)7-8(10)5(12)3-6(13)9(7)11/h3-4H,1-2H3 |
| InChIKey | MYHVXECIIXKMQZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.06 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|