C8H7ClF2 — CID 143320030
2-chloro-1,5-difluoro-3,4-dimethylbenzene (PubChem CID 143320030) has the molecular formula C8H7ClF2 and a molecular weight of 176.59 g/mol. Its IUPAC name is 2-chloro-1,5-difluoro-3,4-dimethylbenzene.
| Compound Name | 2-chloro-1,5-difluoro-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 143320030 |
| Molecular Formula | C8H7ClF2 |
| Molecular Weight | 176.59 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-chloro-1,5-difluoro-3,4-dimethylbenzene |
| SMILES | Cc1c(F)cc(F)c(Cl)c1C |
| InChI | InChI=1S/C8H7ClF2/c1-4-5(2)8(9)7(11)3-6(4)10/h3H,1-2H3 |
| InChIKey | IFVMSWJKWBYAPI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|