C9H11Cl2F — CID 142574555
1,5-dichloro-3-fluoro-2-methylbenzene;ethane (PubChem CID 142574555) has the molecular formula C9H11Cl2F and a molecular weight of 209.09 g/mol. Its IUPAC name is 1,5-dichloro-3-fluoro-2-methylbenzene;ethane.
| Compound Name | 1,5-dichloro-3-fluoro-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 142574555 |
| Molecular Formula | C9H11Cl2F |
| Molecular Weight | 209.09 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 1,5-dichloro-3-fluoro-2-methylbenzene;ethane |
| SMILES | CC.Cc1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2F.C2H6/c1-4-6(9)2-5(8)3-7(4)10;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | GRZZIQWHLUEHKS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |