C9H9Cl2FO — CID 125116033
1,5-dichloro-3-fluoro-2-propan-2-yloxybenzene (PubChem CID 125116033) has the molecular formula C9H9Cl2FO and a molecular weight of 223.07 g/mol. Its IUPAC name is 1,5-dichloro-3-fluoro-2-propan-2-yloxybenzene.
| Compound Name | 1,5-dichloro-3-fluoro-2-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 125116033 |
| Molecular Formula | C9H9Cl2FO |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 1,5-dichloro-3-fluoro-2-propan-2-yloxybenzene |
| SMILES | CC(C)Oc1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2FO/c1-5(2)13-9-7(11)3-6(10)4-8(9)12/h3-5H,1-2H3 |
| InChIKey | GLUPDIGKQLNZKC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |