C10H13Cl2NO — CID 82267076
3,5-dichloro-N-methyl-2-propan-2-yloxyaniline (PubChem CID 82267076) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-2-propan-2-yloxyaniline.
| Compound Name | 3,5-dichloro-N-methyl-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 82267076 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3,5-dichloro-N-methyl-2-propan-2-yloxyaniline |
| SMILES | CNc1cc(Cl)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C10H13Cl2NO/c1-6(2)14-10-8(12)4-7(11)5-9(10)13-3/h4-6,13H,1-3H3 |
| InChIKey | KVIOLCQOUJBFAJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |