C11H14Cl3NO — CID 175035603
N-ethyl-2-(2,4,6-trichlorophenoxy)propan-1-amine (PubChem CID 175035603) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is N-ethyl-2-(2,4,6-trichlorophenoxy)propan-1-amine.
| Compound Name | N-ethyl-2-(2,4,6-trichlorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 175035603 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N-ethyl-2-(2,4,6-trichlorophenoxy)propan-1-amine |
| SMILES | CCNCC(C)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO/c1-3-15-6-7(2)16-11-9(13)4-8(12)5-10(11)14/h4-5,7,15H,3,6H2,1-2H3 |
| InChIKey | HXKKPRZETCIZCW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |