C13H17Cl2N3O3 — CID 43515774
N-carbamoyl-2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]propanamide (PubChem CID 43515774) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is N-carbamoyl-2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]propanamide.
| Compound Name | N-carbamoyl-2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 43515774 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-carbamoyl-2-[2,4-dichloro-6-(ethylaminomethyl)phenoxy]propanamide |
| SMILES | CCNCc1cc(Cl)cc(Cl)c1OC(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H17Cl2N3O3/c1-3-17-6-8-4-9(14)5-10(15)11(8)21-7(2)12(19)18-13(16)20/h4-5,7,17H,3,6H2,1-2H3,(H3,16,18,19,20) |
| InChIKey | IPMSWKKEICTPAN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |