C13H18Cl2N2O2 — CID 43515707
2-[2,4-dichloro-6-(methylaminomethyl)phenoxy]-N-ethylpropanamide (PubChem CID 43515707) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-(methylaminomethyl)phenoxy]-N-ethylpropanamide.
| Compound Name | 2-[2,4-dichloro-6-(methylaminomethyl)phenoxy]-N-ethylpropanamide |
|---|---|
| PubChem CID | 43515707 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[2,4-dichloro-6-(methylaminomethyl)phenoxy]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Oc1c(Cl)cc(Cl)cc1CNC |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-4-17-13(18)8(2)19-12-9(7-16-3)5-10(14)6-11(12)15/h5-6,8,16H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | UREHUWUPVSVKPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |