C15H21Cl2NO3 — CID 43516286
2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-pentylpropanamide (PubChem CID 43516286) has the molecular formula C15H21Cl2NO3 and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-pentylpropanamide.
| Compound Name | 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-pentylpropanamide |
|---|---|
| PubChem CID | 43516286 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C(C)Oc1c(Cl)cc(Cl)cc1CO |
| InChI | InChI=1S/C15H21Cl2NO3/c1-3-4-5-6-18-15(20)10(2)21-14-11(9-19)7-12(16)8-13(14)17/h7-8,10,19H,3-6,9H2,1-2H3,(H,18,20) |
| InChIKey | BUHFMDCAXVAEDL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|